C20H27BrFN5O3 — CID 163239334
(2R,3R,4S,5R)-2-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-5-(3-fluoropiperidin-1-yl)pent-1-enyl]oxolane-3,4-diol (PubChem CID 163239334) has the molecular formula C20H27BrFN5O3 and a molecular weight of 484.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-5-(3-fluoropiperidin-1-yl)pent-1-enyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-5-(3-fluoropiperidin-1-yl)pent-1-enyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 163239334 |
| Molecular Formula | C20H27BrFN5O3 |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-5-(3-fluoropiperidin-1-yl)pent-1-enyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1c(Br)cn2[C@@H]1O[C@H](/C=C/CCCN2CCCC(F)C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H27BrFN5O3/c21-13-10-27(19-15(13)18(23)24-11-25-19)20-17(29)16(28)14(30-20)6-2-1-3-7-26-8-4-5-12(22)9-26/h2,6,10-12,14,16-17,20,28-29H,1,3-5,7-9H2,(H2,23,24,25)/b6-2+/t12?,14-,16-,17-,20-/m1/s1 |
| InChIKey | HGXMRDNOWZGHFE-NFUHSAPESA-N |
| XLogP | 2.17 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|