C11H14BrN5 — CID 164579497
5-bromo-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 164579497) has the molecular formula C11H14BrN5 and a molecular weight of 296.17 g/mol. Its IUPAC name is 5-bromo-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-bromo-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164579497 |
| Molecular Formula | C11H14BrN5 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-bromo-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(Br)cn2C1CCNCC1 |
| InChI | InChI=1S/C11H14BrN5/c12-8-5-17(7-1-3-14-4-2-7)11-9(8)10(13)15-6-16-11/h5-7,14H,1-4H2,(H2,13,15,16) |
| InChIKey | DPZKEPVYNZLLPC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |