C23H31BrN6 — CID 167461823
N'-[[3-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine (PubChem CID 167461823) has the molecular formula C23H31BrN6 and a molecular weight of 471.45 g/mol. Its IUPAC name is N'-[[3-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine.
| Compound Name | N'-[[3-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 167461823 |
| Molecular Formula | C23H31BrN6 |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N'-[[3-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine |
| SMILES | Nc1ncnc2c1c(Br)cn2C1CCC(CNCCCNCCc2ccccc2)C1 |
| InChI | InChI=1S/C23H31BrN6/c24-20-15-30(23-21(20)22(25)28-16-29-23)19-8-7-18(13-19)14-27-11-4-10-26-12-9-17-5-2-1-3-6-17/h1-3,5-6,15-16,18-19,26-27H,4,7-14H2,(H2,25,28,29) |
| InChIKey | QLTLMXOLNUMPBP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|