C32H50N6O2 — CID 167460833
N'-[[3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine;propane-2,2-diol (PubChem CID 167460833) has the molecular formula C32H50N6O2 and a molecular weight of 550.79 g/mol. Its IUPAC name is N'-[[3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine;propane-2,2-diol.
| Compound Name | N'-[[3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine;propane-2,2-diol |
|---|---|
| PubChem CID | 167460833 |
| Molecular Formula | C32H50N6O2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | N'-[[3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]-N-(2-phenylethyl)propane-1,3-diamine;propane-2,2-diol |
| SMILES | CC(C)(O)O.Nc1ncnc2c1c(C1CCCCC1)cn2C1CCC(CNCCCNCCc2ccccc2)C1 |
| InChI | InChI=1S/C29H42N6.C3H8O2/c30-28-27-26(24-10-5-2-6-11-24)20-35(29(27)34-21-33-28)25-13-12-23(18-25)19-32-16-7-15-31-17-14-22-8-3-1-4-9-22;1-3(2,4)5/h1,3-4,8-9,20-21,23-25,31-32H,2,5-7,10-19H2,(H2,30,33,34);4-5H,1-2H3 |
| InChIKey | VZWDTAKOCGVOLV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|