C23H31N5OS — CID 167462051
N-methyl-7-[3-[2-(2-phenylethylamino)ethylsulfinylmethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 167462051) has the molecular formula C23H31N5OS and a molecular weight of 425.60 g/mol. Its IUPAC name is N-methyl-7-[3-[2-(2-phenylethylamino)ethylsulfinylmethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-7-[3-[2-(2-phenylethylamino)ethylsulfinylmethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167462051 |
| Molecular Formula | C23H31N5OS |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N-methyl-7-[3-[2-(2-phenylethylamino)ethylsulfinylmethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1ncnc2c1ccn2C1CCC(CS(=O)CCNCCc2ccccc2)C1 |
| InChI | InChI=1S/C23H31N5OS/c1-24-22-21-10-13-28(23(21)27-17-26-22)20-8-7-19(15-20)16-30(29)14-12-25-11-9-18-5-3-2-4-6-18/h2-6,10,13,17,19-20,25H,7-9,11-12,14-16H2,1H3,(H,24,26,27) |
| InChIKey | LWAIZSQGKZQZJG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|