C24H33N5O2S — CID 167460810
(1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[3-(2-phenylethylamino)propylsulfanylmethyl]cyclopentane-1,2-diol (PubChem CID 167460810) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[3-(2-phenylethylamino)propylsulfanylmethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[3-(2-phenylethylamino)propylsulfanylmethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 167460810 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[3-(2-phenylethylamino)propylsulfanylmethyl]cyclopentane-1,2-diol |
| SMILES | CNc1ncnc2c1ccn2[C@@H]1C[C@H](CSCCCNCCc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H33N5O2S/c1-25-23-19-9-12-29(24(19)28-16-27-23)20-14-18(21(30)22(20)31)15-32-13-5-10-26-11-8-17-6-3-2-4-7-17/h2-4,6-7,9,12,16,18,20-22,26,30-31H,5,8,10-11,13-15H2,1H3,(H,25,27,28)/t18-,20-,21-,22+/m1/s1 |
| InChIKey | IZKGBLYZSNAREG-NMIHRBCNSA-N |
| XLogP | 2.71 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|