C19H28N6O2 — CID 167461774
(1S,2R,3R,5R)-3-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol (PubChem CID 167461774) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 167461774 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1S,2R,3R,5R)-3-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
| SMILES | CNc1ncnc2c1ccn2[C@@H]1C[C@H](CN2CCC23CCNC3)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H28N6O2/c1-20-17-13-2-6-25(18(13)23-11-22-17)14-8-12(15(26)16(14)27)9-24-7-4-19(24)3-5-21-10-19/h2,6,11-12,14-16,21,26-27H,3-5,7-10H2,1H3,(H,20,22,23)/t12-,14-,15-,16+,19?/m1/s1 |
| InChIKey | FJSVHUZOQBZDTC-JIPRACADSA-N |
| XLogP | 0.19 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |