C19H23IN4O2 — CID 162660980
(1R,2R,3S,4R,5S)-4-[4-(dicyclopropylmethylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 162660980) has the molecular formula C19H23IN4O2 and a molecular weight of 466.32 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[4-(dicyclopropylmethylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[4-(dicyclopropylmethylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 162660980 |
| Molecular Formula | C19H23IN4O2 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[4-(dicyclopropylmethylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H]2C[C@@H]2[C@H]1n1ccc2c(NC(C3CC3)C3CC3)nc(I)nc21 |
| InChI | InChI=1S/C19H23IN4O2/c20-19-22-17(21-13(8-1-2-8)9-3-4-9)10-5-6-24(18(10)23-19)14-11-7-12(11)15(25)16(14)26/h5-6,8-9,11-16,25-26H,1-4,7H2,(H,21,22,23)/t11-,12+,14+,15+,16-/m0/s1 |
| InChIKey | QPHSMEXKXHZHKT-USNPWTNRSA-N |
| XLogP | 2.55 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|