C20H34FN5O2 — CID 167461733
N'-[[3-(4,5-dimethylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]propane-1,3-diamine;2-hydroxypropan-2-yl hypofluorite (PubChem CID 167461733) has the molecular formula C20H34FN5O2 and a molecular weight of 395.52 g/mol. Its IUPAC name is N'-[[3-(4,5-dimethylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]propane-1,3-diamine;2-hydroxypropan-2-yl hypofluorite.
| Compound Name | N'-[[3-(4,5-dimethylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]propane-1,3-diamine;2-hydroxypropan-2-yl hypofluorite |
|---|---|
| PubChem CID | 167461733 |
| Molecular Formula | C20H34FN5O2 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | N'-[[3-(4,5-dimethylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl]propane-1,3-diamine;2-hydroxypropan-2-yl hypofluorite |
| SMILES | CC(C)(O)OF.Cc1cn(C2CCC(CNCCCN)C2)c2ncnc(C)c12 |
| InChI | InChI=1S/C17H27N5.C3H7FO2/c1-12-10-22(17-16(12)13(2)20-11-21-17)15-5-4-14(8-15)9-19-7-3-6-18;1-3(2,5)6-4/h10-11,14-15,19H,3-9,18H2,1-2H3;5H,1-2H3 |
| InChIKey | DRBAOCZMJXCZGZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|