C21H31N5O2 — CID 167460629
tert-butyl N-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-3-yl)cyclopentyl]methyl]carbamate (PubChem CID 167460629) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-3-yl)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-3-yl)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 167460629 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | tert-butyl N-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-3-yl)cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CC[C@H](n2cc3c4c(ncnc42)NCCCC3)C1 |
| InChI | InChI=1S/C21H31N5O2/c1-21(2,3)28-20(27)23-11-14-7-8-16(10-14)26-12-15-6-4-5-9-22-18-17(15)19(26)25-13-24-18/h12-14,16H,4-11H2,1-3H3,(H,23,27)(H,22,24,25)/t14-,16+/m1/s1 |
| InChIKey | IBDCWOLGYUKXGV-ZBFHGGJFSA-N |
| XLogP | 4.05 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |