C14H23FN2O — CID 163242539
2-aminopropanal;1-(4-fluorophenyl)-N,2-dimethylpropan-2-amine (PubChem CID 163242539) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-aminopropanal;1-(4-fluorophenyl)-N,2-dimethylpropan-2-amine.
| Compound Name | 2-aminopropanal;1-(4-fluorophenyl)-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 163242539 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-aminopropanal;1-(4-fluorophenyl)-N,2-dimethylpropan-2-amine |
| SMILES | CC(N)C=O.CNC(C)(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H16FN.C3H7NO/c1-11(2,13-3)8-9-4-6-10(12)7-5-9;1-3(4)2-5/h4-7,13H,8H2,1-3H3;2-3H,4H2,1H3 |
| InChIKey | GYMCKSKRMHLYFY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|