C19H20ClN5O2S — CID 163243958
ethyl 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-5-carboxylate (PubChem CID 163243958) has the molecular formula C19H20ClN5O2S and a molecular weight of 417.92 g/mol. Its IUPAC name is ethyl 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 163243958 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | ethyl 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(SNc2nc(Cl)cc(-c3c(C)cccc3C)n2)nn1C |
| InChI | InChI=1S/C19H20ClN5O2S/c1-5-27-18(26)14-10-16(23-25(14)4)28-24-19-21-13(9-15(20)22-19)17-11(2)7-6-8-12(17)3/h6-10H,5H2,1-4H3,(H,21,22,24) |
| InChIKey | NSUGSMSDJUSIFH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|