C35H32N4O4S — CID 163244938
(10R)-10,12-dibenzyl-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one (PubChem CID 163244938) has the molecular formula C35H32N4O4S and a molecular weight of 604.73 g/mol. Its IUPAC name is (10R)-10,12-dibenzyl-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one.
| Compound Name | (10R)-10,12-dibenzyl-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one |
|---|---|
| PubChem CID | 163244938 |
| Molecular Formula | C35H32N4O4S |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | (10R)-10,12-dibenzyl-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)(=O)c1cccc(c1)C(=O)N(Cc1ccccc1)C[C@@H](Cc1ccccc1)O2 |
| InChI | InChI=1S/C35H32N4O4S/c1-24-11-9-12-25(2)33(24)31-21-32-37-35(36-31)38-44(41,42)30-18-10-17-28(20-30)34(40)39(22-27-15-7-4-8-16-27)23-29(43-32)19-26-13-5-3-6-14-26/h3-18,20-21,29H,19,22-23H2,1-2H3,(H,36,37,38)/t29-/m1/s1 |
| InChIKey | VEOVYNIJJOTCHT-GDLZYMKVSA-N |
| XLogP | 6.21 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |