C29H37N5O4S — CID 171464500
(10S)-10-[(3,3-dimethylbutylamino)methyl]-6-(2,6-dimethylphenyl)-12-methyl-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one (PubChem CID 171464500) has the molecular formula C29H37N5O4S and a molecular weight of 551.71 g/mol. Its IUPAC name is (10S)-10-[(3,3-dimethylbutylamino)methyl]-6-(2,6-dimethylphenyl)-12-methyl-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one.
| Compound Name | (10S)-10-[(3,3-dimethylbutylamino)methyl]-6-(2,6-dimethylphenyl)-12-methyl-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one |
|---|---|
| PubChem CID | 171464500 |
| Molecular Formula | C29H37N5O4S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (10S)-10-[(3,3-dimethylbutylamino)methyl]-6-(2,6-dimethylphenyl)-12-methyl-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)(=O)c1cccc(c1)C(=O)N(C)C[C@H](CNCCC(C)(C)C)O2 |
| InChI | InChI=1S/C29H37N5O4S/c1-19-9-7-10-20(2)26(19)24-16-25-32-28(31-24)33-39(36,37)23-12-8-11-21(15-23)27(35)34(6)18-22(38-25)17-30-14-13-29(3,4)5/h7-12,15-16,22,30H,13-14,17-18H2,1-6H3,(H,31,32,33)/t22-/m0/s1 |
| InChIKey | GJRWCFDLDWUWDD-QFIPXVFZSA-N |
| XLogP | 4.42 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|