C26H28ClN7OS — CID 163247147
5-chloro-4-(2-methylphenyl)-6-[3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine (PubChem CID 163247147) has the molecular formula C26H28ClN7OS and a molecular weight of 522.08 g/mol. Its IUPAC name is 5-chloro-4-(2-methylphenyl)-6-[3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine.
| Compound Name | 5-chloro-4-(2-methylphenyl)-6-[3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 163247147 |
| Molecular Formula | C26H28ClN7OS |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 5-chloro-4-(2-methylphenyl)-6-[3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
| SMILES | Cc1ccccc1-c1nc(NSc2cnn(C)c2)nc(Oc2cccc(N3CCN(C)CC3)c2)c1Cl |
| InChI | InChI=1S/C26H28ClN7OS/c1-18-7-4-5-10-22(18)24-23(27)25(30-26(29-24)31-36-21-16-28-33(3)17-21)35-20-9-6-8-19(15-20)34-13-11-32(2)12-14-34/h4-10,15-17H,11-14H2,1-3H3,(H,29,30,31) |
| InChIKey | ALOHOSBVNUCNQJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|