C25H38F2N4 — CID 163248320
N'-[(4S)-3-[6-amino-3-(1,1-difluoroethyl)-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-2,3-dihydropyridin-4-yl]-4-methylcyclohexa-1,5-dien-1-yl]-N'-ethylethane-1,2-diamine (PubChem CID 163248320) has the molecular formula C25H38F2N4 and a molecular weight of 432.60 g/mol. Its IUPAC name is N'-[(4S)-3-[6-amino-3-(1,1-difluoroethyl)-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-2,3-dihydropyridin-4-yl]-4-methylcyclohexa-1,5-dien-1-yl]-N'-ethylethane-1,2-diamine.
| Compound Name | N'-[(4S)-3-[6-amino-3-(1,1-difluoroethyl)-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-2,3-dihydropyridin-4-yl]-4-methylcyclohexa-1,5-dien-1-yl]-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 163248320 |
| Molecular Formula | C25H38F2N4 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | N'-[(4S)-3-[6-amino-3-(1,1-difluoroethyl)-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-2,3-dihydropyridin-4-yl]-4-methylcyclohexa-1,5-dien-1-yl]-N'-ethylethane-1,2-diamine |
| SMILES | C/C=C(C)\C(=C/C)C1N=C(N)C=C(C2C=C(N(CC)CCN)C=C[C@@H]2C)C1C(C)(F)F |
| InChI | InChI=1S/C25H38F2N4/c1-7-16(4)19(8-2)24-23(25(6,26)27)21(15-22(29)30-24)20-14-18(11-10-17(20)5)31(9-3)13-12-28/h7-8,10-11,14-15,17,20,23-24H,9,12-13,28H2,1-6H3,(H2,29,30)/b16-7-,19-8+/t17-,20?,23?,24?/m0/s1 |
| InChIKey | GOCTYWRTXOKBHY-KVYJQUFQSA-N |
| XLogP | 4.82 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|