C26H39F2N3 — CID 163248382
3-(difluoromethyl)-2-[(1E,5E)-hepta-1,5-dienyl]-4-[[(4S)-4-[1-(methylamino)pentan-3-yl]cyclohexa-1,5-dien-1-yl]methyl]-2,3-dihydropyridin-6-amine (PubChem CID 163248382) has the molecular formula C26H39F2N3 and a molecular weight of 431.62 g/mol. Its IUPAC name is 3-(difluoromethyl)-2-[(1E,5E)-hepta-1,5-dienyl]-4-[[(4S)-4-[1-(methylamino)pentan-3-yl]cyclohexa-1,5-dien-1-yl]methyl]-2,3-dihydropyridin-6-amine.
| Compound Name | 3-(difluoromethyl)-2-[(1E,5E)-hepta-1,5-dienyl]-4-[[(4S)-4-[1-(methylamino)pentan-3-yl]cyclohexa-1,5-dien-1-yl]methyl]-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 163248382 |
| Molecular Formula | C26H39F2N3 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | 3-(difluoromethyl)-2-[(1E,5E)-hepta-1,5-dienyl]-4-[[(4S)-4-[1-(methylamino)pentan-3-yl]cyclohexa-1,5-dien-1-yl]methyl]-2,3-dihydropyridin-6-amine |
| SMILES | C/C=C/CC/C=C/C1N=C(N)C=C(CC2=CCC(C(CC)CCNC)C=C2)C1C(F)F |
| InChI | InChI=1S/C26H39F2N3/c1-4-6-7-8-9-10-23-25(26(27)28)22(18-24(29)31-23)17-19-11-13-21(14-12-19)20(5-2)15-16-30-3/h4,6,9-13,18,20-21,23,25-26,30H,5,7-8,14-17H2,1-3H3,(H2,29,31)/b6-4+,10-9+ |
| InChIKey | DFNILYVMBIWISF-FTDKHJNJSA-N |
| XLogP | 5.97 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|