C18H32FN3 — CID 144943529
N'-ethylpropanimidamide;6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-5-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 144943529) has the molecular formula C18H32FN3 and a molecular weight of 309.47 g/mol. Its IUPAC name is N'-ethylpropanimidamide;6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-5-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | N'-ethylpropanimidamide;6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-5-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 144943529 |
| Molecular Formula | C18H32FN3 |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | N'-ethylpropanimidamide;6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-5-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC/N=C(/N)CC.CC1=CCCNC1C1C=CC(F)C(C)C1 |
| InChI | InChI=1S/C13H20FN.C5H12N2/c1-9-4-3-7-15-13(9)11-5-6-12(14)10(2)8-11;1-3-5(6)7-4-2/h4-6,10-13,15H,3,7-8H2,1-2H3;3-4H2,1-2H3,(H2,6,7) |
| InChIKey | YUFHPKUXJFROGS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|