C31H45F2N3 — CID 163248400
N'-[(4S)-4-[(Z)-4-cyclohexa-1,5-dien-1-yl-2-(2,2-difluoroethyl)-4-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]iminobut-2-enyl]cyclohexa-1,5-dien-1-yl]-N'-ethyl-N-methylethane-1,2-diamine (PubChem CID 163248400) has the molecular formula C31H45F2N3 and a molecular weight of 497.72 g/mol. Its IUPAC name is N'-[(4S)-4-[(Z)-4-cyclohexa-1,5-dien-1-yl-2-(2,2-difluoroethyl)-4-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]iminobut-2-enyl]cyclohexa-1,5-dien-1-yl]-N'-ethyl-N-methylethane-1,2-diamine.
| Compound Name | N'-[(4S)-4-[(Z)-4-cyclohexa-1,5-dien-1-yl-2-(2,2-difluoroethyl)-4-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]iminobut-2-enyl]cyclohexa-1,5-dien-1-yl]-N'-ethyl-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 163248400 |
| Molecular Formula | C31H45F2N3 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.36 |
| IUPAC Name | N'-[(4S)-4-[(Z)-4-cyclohexa-1,5-dien-1-yl-2-(2,2-difluoroethyl)-4-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]iminobut-2-enyl]cyclohexa-1,5-dien-1-yl]-N'-ethyl-N-methylethane-1,2-diamine |
| SMILES | C/C=C(C)\C(=C/C)C/N=C(/C=C(\CC(F)F)C[C@H]1C=CC(N(CC)CCNC)=CC1)C1=CCCC=C1 |
| InChI | InChI=1S/C31H45F2N3/c1-6-24(4)27(7-2)23-35-30(28-12-10-9-11-13-28)21-26(22-31(32)33)20-25-14-16-29(17-15-25)36(8-3)19-18-34-5/h6-7,10,12-14,16-17,21,25,31,34H,8-9,11,15,18-20,22-23H2,1-5H3/b24-6-,26-21-,27-7-,35-30-/t25-/m0/s1 |
| InChIKey | LRYOOOZAGVPOHU-ZSIKVHIRSA-N |
| XLogP | 7.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|