C30H46FN3 — CID 153383278
(6Z)-6-ethylidene-2-fluoro-N-methyl-4-[(2E,4E)-4-methyl-5-(4-piperidin-4-ylpentan-2-ylideneamino)hepta-2,4,6-trien-2-yl]cyclohexa-2,4-dien-1-imine;propane (PubChem CID 153383278) has the molecular formula C30H46FN3 and a molecular weight of 467.72 g/mol. Its IUPAC name is (6Z)-6-ethylidene-2-fluoro-N-methyl-4-[(2E,4E)-4-methyl-5-(4-piperidin-4-ylpentan-2-ylideneamino)hepta-2,4,6-trien-2-yl]cyclohexa-2,4-dien-1-imine;propane.
| Compound Name | (6Z)-6-ethylidene-2-fluoro-N-methyl-4-[(2E,4E)-4-methyl-5-(4-piperidin-4-ylpentan-2-ylideneamino)hepta-2,4,6-trien-2-yl]cyclohexa-2,4-dien-1-imine;propane |
|---|---|
| PubChem CID | 153383278 |
| Molecular Formula | C30H46FN3 |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.37 |
| IUPAC Name | (6Z)-6-ethylidene-2-fluoro-N-methyl-4-[(2E,4E)-4-methyl-5-(4-piperidin-4-ylpentan-2-ylideneamino)hepta-2,4,6-trien-2-yl]cyclohexa-2,4-dien-1-imine;propane |
| SMILES | C=CC(/N=C(\C)CC(C)C1CCNCC1)=C(C)\C=C(/C)C1=CC(=C/C)/C(=N/C)C(F)=C1.CCC |
| InChI | InChI=1S/C27H38FN3.C3H8/c1-8-22-16-24(17-25(28)27(22)29-7)18(3)14-20(5)26(9-2)31-21(6)15-19(4)23-10-12-30-13-11-23;1-3-2/h8-9,14,16-17,19,23,30H,2,10-13,15H2,1,3-7H3;3H2,1-2H3/b18-14+,22-8-,26-20+,29-27-,31-21+; |
| InChIKey | KSNUWSVUYUGHLT-UGLBQXCESA-N |
| XLogP | 8.11 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|