C22H27FN4 — CID 153383620
1-[(3E)-5-fluoro-6-methylidene-3-(3-methyl-2-piperidin-4-yl-3,4,6,7-tetrahydropyrrolo[3,2-b]pyridin-5-ylidene)cyclohexa-1,4-dien-1-yl]-N-methylmethanimine (PubChem CID 153383620) has the molecular formula C22H27FN4 and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-[(3E)-5-fluoro-6-methylidene-3-(3-methyl-2-piperidin-4-yl-3,4,6,7-tetrahydropyrrolo[3,2-b]pyridin-5-ylidene)cyclohexa-1,4-dien-1-yl]-N-methylmethanimine.
| Compound Name | 1-[(3E)-5-fluoro-6-methylidene-3-(3-methyl-2-piperidin-4-yl-3,4,6,7-tetrahydropyrrolo[3,2-b]pyridin-5-ylidene)cyclohexa-1,4-dien-1-yl]-N-methylmethanimine |
|---|---|
| PubChem CID | 153383620 |
| Molecular Formula | C22H27FN4 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 1-[(3E)-5-fluoro-6-methylidene-3-(3-methyl-2-piperidin-4-yl-3,4,6,7-tetrahydropyrrolo[3,2-b]pyridin-5-ylidene)cyclohexa-1,4-dien-1-yl]-N-methylmethanimine |
| SMILES | C=c1c(F)c/c(=C2\CCC3=C(N2)C(C)C(C2CCNCC2)=N3)cc1/C=N/C |
| InChI | InChI=1S/C22H27FN4/c1-13-17(12-24-3)10-16(11-18(13)23)19-4-5-20-22(26-19)14(2)21(27-20)15-6-8-25-9-7-15/h10-12,14-15,25-26H,1,4-9H2,2-3H3/b19-16+,24-12+ |
| InChIKey | SPFPFTAHSLLYNR-IDMARDDYSA-N |
| XLogP | 2.08 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|