C22H28FN4+ — CID 163867619
6-[5-(1-fluoro-2-methylprop-2-enyl)-3,4-dihydropyrrol-1-ium-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine (PubChem CID 163867619) has the molecular formula C22H28FN4+ and a molecular weight of 367.49 g/mol. Its IUPAC name is 6-[5-(1-fluoro-2-methylprop-2-enyl)-3,4-dihydropyrrol-1-ium-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine.
| Compound Name | 6-[5-(1-fluoro-2-methylprop-2-enyl)-3,4-dihydropyrrol-1-ium-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 163867619 |
| Molecular Formula | C22H28FN4+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 6-[5-(1-fluoro-2-methylprop-2-enyl)-3,4-dihydropyrrol-1-ium-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
| SMILES | C=C(C)C(F)C1=[N+]=CC(c2cc(NC3CCNCC3)c3c(c2)=CCNC=3)C1 |
| InChI | InChI=1S/C22H28FN4/c1-14(2)22(23)21-11-17(12-26-21)16-9-15-3-6-25-13-19(15)20(10-16)27-18-4-7-24-8-5-18/h3,9-10,12-13,17-18,22,24-25,27H,1,4-8,11H2,2H3/q+1 |
| InChIKey | PIAHSRKPHBKGOT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|