C19H26N6O2 — CID 163253366
4-[[4-methoxy-6-[(1-methylimidazol-4-yl)amino]pyrimidin-2-yl]amino]adamantan-1-ol (PubChem CID 163253366) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-[[4-methoxy-6-[(1-methylimidazol-4-yl)amino]pyrimidin-2-yl]amino]adamantan-1-ol.
| Compound Name | 4-[[4-methoxy-6-[(1-methylimidazol-4-yl)amino]pyrimidin-2-yl]amino]adamantan-1-ol |
|---|---|
| PubChem CID | 163253366 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-[[4-methoxy-6-[(1-methylimidazol-4-yl)amino]pyrimidin-2-yl]amino]adamantan-1-ol |
| SMILES | COc1cc(Nc2cn(C)cn2)nc(NC2C3CC4CC2CC(O)(C4)C3)n1 |
| InChI | InChI=1S/C19H26N6O2/c1-25-9-15(20-10-25)21-14-5-16(27-2)23-18(22-14)24-17-12-3-11-4-13(17)8-19(26,6-11)7-12/h5,9-13,17,26H,3-4,6-8H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | HKNIWDBXPGHZSX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |