C25H35N4O4P — CID 88570553
4-[[2-[3-(diethoxyphosphorylmethyl)anilino]pyrimidin-4-yl]amino]adamantan-1-ol (PubChem CID 88570553) has the molecular formula C25H35N4O4P and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-[[2-[3-(diethoxyphosphorylmethyl)anilino]pyrimidin-4-yl]amino]adamantan-1-ol.
| Compound Name | 4-[[2-[3-(diethoxyphosphorylmethyl)anilino]pyrimidin-4-yl]amino]adamantan-1-ol |
|---|---|
| PubChem CID | 88570553 |
| Molecular Formula | C25H35N4O4P |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 4-[[2-[3-(diethoxyphosphorylmethyl)anilino]pyrimidin-4-yl]amino]adamantan-1-ol |
| SMILES | CCOP(=O)(Cc1cccc(Nc2nccc(NC3C4CC5CC3CC(O)(C5)C4)n2)c1)OCC |
| InChI | InChI=1S/C25H35N4O4P/c1-3-32-34(31,33-4-2)16-17-6-5-7-21(12-17)27-24-26-9-8-22(29-24)28-23-19-10-18-11-20(23)15-25(30,13-18)14-19/h5-9,12,18-20,23,30H,3-4,10-11,13-16H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | WZJOLTILTUMAMP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|