C25H28N6O2 — CID 123142363
4-[[5-methyl-2-(3-pyrimidin-2-yloxyanilino)pyrimidin-4-yl]amino]adamantan-1-ol (PubChem CID 123142363) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-[[5-methyl-2-(3-pyrimidin-2-yloxyanilino)pyrimidin-4-yl]amino]adamantan-1-ol.
| Compound Name | 4-[[5-methyl-2-(3-pyrimidin-2-yloxyanilino)pyrimidin-4-yl]amino]adamantan-1-ol |
|---|---|
| PubChem CID | 123142363 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-[[5-methyl-2-(3-pyrimidin-2-yloxyanilino)pyrimidin-4-yl]amino]adamantan-1-ol |
| SMILES | Cc1cnc(Nc2cccc(Oc3ncccn3)c2)nc1NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C25H28N6O2/c1-15-14-28-23(29-19-4-2-5-20(10-19)33-24-26-6-3-7-27-24)31-22(15)30-21-17-8-16-9-18(21)13-25(32,11-16)12-17/h2-7,10,14,16-18,21,32H,8-9,11-13H2,1H3,(H2,28,29,30,31) |
| InChIKey | AHANSNZGYBYHFG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |