C23H30N4O2 — CID 89432659
1-[(1S,3R)-3-[[2-(3-methoxyanilino)-5-methylpyrimidin-4-yl]amino]cyclohexyl]-3-methylbut-2-en-1-one (PubChem CID 89432659) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[(1S,3R)-3-[[2-(3-methoxyanilino)-5-methylpyrimidin-4-yl]amino]cyclohexyl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(1S,3R)-3-[[2-(3-methoxyanilino)-5-methylpyrimidin-4-yl]amino]cyclohexyl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 89432659 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[(1S,3R)-3-[[2-(3-methoxyanilino)-5-methylpyrimidin-4-yl]amino]cyclohexyl]-3-methylbut-2-en-1-one |
| SMILES | COc1cccc(Nc2ncc(C)c(N[C@@H]3CCC[C@H](C(=O)C=C(C)C)C3)n2)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-15(2)11-21(28)17-7-5-8-18(12-17)25-22-16(3)14-24-23(27-22)26-19-9-6-10-20(13-19)29-4/h6,9-11,13-14,17-18H,5,7-8,12H2,1-4H3,(H2,24,25,26,27)/t17-,18+/m0/s1 |
| InChIKey | QJUHITCIHWBWHS-ZWKOTPCHSA-N |
| XLogP | 5.04 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|