C30H36N4O3 — CID 143999950
4-[(5-hydroxy-2-adamantyl)amino]-6-(4-methoxyanilino)pyridine-3-carboxamide;toluene (PubChem CID 143999950) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-[(5-hydroxy-2-adamantyl)amino]-6-(4-methoxyanilino)pyridine-3-carboxamide;toluene.
| Compound Name | 4-[(5-hydroxy-2-adamantyl)amino]-6-(4-methoxyanilino)pyridine-3-carboxamide;toluene |
|---|---|
| PubChem CID | 143999950 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 4-[(5-hydroxy-2-adamantyl)amino]-6-(4-methoxyanilino)pyridine-3-carboxamide;toluene |
| SMILES | COc1ccc(Nc2cc(NC3C4CC5CC3CC(O)(C5)C4)c(C(N)=O)cn2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O3.C7H8/c1-30-17-4-2-16(3-5-17)26-20-8-19(18(12-25-20)22(24)28)27-21-14-6-13-7-15(21)11-23(29,9-13)10-14;1-7-5-3-2-4-6-7/h2-5,8,12-15,21,29H,6-7,9-11H2,1H3,(H2,24,28)(H2,25,26,27);2-6H,1H3 |
| InChIKey | WFACUGIRARINSO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |