C20H24N6O2 — CID 67371527
4-[[(1R,3S)-5-hydroxy-2-adamantyl]amino]-6-(pyrazin-2-ylamino)pyridine-3-carboxamide (PubChem CID 67371527) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-[[(1R,3S)-5-hydroxy-2-adamantyl]amino]-6-(pyrazin-2-ylamino)pyridine-3-carboxamide.
| Compound Name | 4-[[(1R,3S)-5-hydroxy-2-adamantyl]amino]-6-(pyrazin-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67371527 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-[[(1R,3S)-5-hydroxy-2-adamantyl]amino]-6-(pyrazin-2-ylamino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2cnccn2)cc1NC1[C@@H]2CC3C[C@H]1CC(O)(C3)C2 |
| InChI | InChI=1S/C20H24N6O2/c21-19(27)14-9-24-16(26-17-10-22-1-2-23-17)5-15(14)25-18-12-3-11-4-13(18)8-20(28,6-11)7-12/h1-2,5,9-13,18,28H,3-4,6-8H2,(H2,21,27)(H2,23,24,25,26)/t11?,12-,13+,18?,20? |
| InChIKey | RYMOLRTUEFRPMP-SGQHNCPESA-N |
| XLogP | 2.07 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |