C26H34N6O2 — CID 57336119
1-[4-[[4-[(5-hydroxy-2-adamantyl)amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxamide (PubChem CID 57336119) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[4-[[4-[(5-hydroxy-2-adamantyl)amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[4-[(5-hydroxy-2-adamantyl)amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 57336119 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 1-[4-[[4-[(5-hydroxy-2-adamantyl)amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(Nc3nccc(NC4C5CC6CC4CC(O)(C6)C5)n3)cc2)CC1 |
| InChI | InChI=1S/C26H34N6O2/c27-24(33)17-6-9-32(10-7-17)21-3-1-20(2-4-21)29-25-28-8-5-22(31-25)30-23-18-11-16-12-19(23)15-26(34,13-16)14-18/h1-5,8,16-19,23,34H,6-7,9-15H2,(H2,27,33)(H2,28,29,30,31) |
| InChIKey | PMGPAPQXVXDEGE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|