About 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine
2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine (PubChem CID 171509372) has the molecular formula C19H28N6
and a molecular weight of 340.48 g/mol. Its IUPAC name is 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine |
| PubChem CID | 171509372 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CCN1CCN(CCc2cccc(Nc3nccc(NC)n3)c2)CC1 |
| InChI | InChI=1S/C19H28N6/c1-3-24-11-13-25(14-12-24)10-8-16-5-4-6-17(15-16)22-19-21-9-7-18(20-2)23-19/h4-7,9,15H,3,8,10-14H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | JFPSFANRCVPMCL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine?
The IUPAC name of 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine (CID 171509372) is 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine is CCN1CCN(CCc2cccc(Nc3nccc(NC)n3)c2)CC1.
What is the InChIKey of 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine?
The InChIKey is JFPSFANRCVPMCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N6/c1-3-24-11-13-25(14-12-24)10-8-16-5-4-6-17(15-16)22-19-21-9-7-18(20-2)23-19/h4-7,9,15H,3,8,10-14H2,1-2H3,(H2,20,21,22,23).
What are the key properties of 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine?
2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine has a molecular weight of 340.48 g/mol, XLogP of 2.44, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[3-[2-(4-ethylpiperazin-1-yl)ethyl]phenyl]-4-N-methylpyrimidine-2,4-diamine is sourced from PubChem (CID 171509372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).