C34H35ClN7OSi — CID 163253504
CID 163253504 (PubChem CID 163253504) has the molecular formula C34H35ClN7OSi and a molecular weight of 621.24 g/mol.
| Compound Name | CID 163253504 |
|---|---|
| PubChem CID | 163253504 |
| Molecular Formula | C34H35ClN7OSi |
| Molecular Weight | 621.24 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | — |
| SMILES | CC(CO[Si](c1ccccc1)c1ccc(C(C)(C)C)cc1)Nc1nc2cc(-c3ccc(Cl)cc3)nc(-c3cnn(C)c3)n2n1 |
| InChI | InChI=1S/C34H35ClN7OSi/c1-23(22-43-44(28-9-7-6-8-10-28)29-17-13-26(14-18-29)34(2,3)4)37-33-39-31-19-30(24-11-15-27(35)16-12-24)38-32(42(31)40-33)25-20-36-41(5)21-25/h6-21,23H,22H2,1-5H3,(H,37,40) |
| InChIKey | IWSJPVSIKXUKOS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.24 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|