C35H34BNO2 — CID 163254303
4,12,20-tritert-butyl-17-oxa-15-aza-8-boraoctacyclo[20.3.1.02,7.06,10.08,25.09,14.015,24.018,23]hexacosa-1(26),2(7),3,5,9,11,13,18(23),19,21,24-undecaen-16-one (PubChem CID 163254303) has the molecular formula C35H34BNO2 and a molecular weight of 511.47 g/mol. Its IUPAC name is 4,12,20-tritert-butyl-17-oxa-15-aza-8-boraoctacyclo[20.3.1.02,7.06,10.08,25.09,14.015,24.018,23]hexacosa-1(26),2(7),3,5,9,11,13,18(23),19,21,24-undecaen-16-one.
| Compound Name | 4,12,20-tritert-butyl-17-oxa-15-aza-8-boraoctacyclo[20.3.1.02,7.06,10.08,25.09,14.015,24.018,23]hexacosa-1(26),2(7),3,5,9,11,13,18(23),19,21,24-undecaen-16-one |
|---|---|
| PubChem CID | 163254303 |
| Molecular Formula | C35H34BNO2 |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 4,12,20-tritert-butyl-17-oxa-15-aza-8-boraoctacyclo[20.3.1.02,7.06,10.08,25.09,14.015,24.018,23]hexacosa-1(26),2(7),3,5,9,11,13,18(23),19,21,24-undecaen-16-one |
| SMILES | CC(C)(C)c1cc2c3c(c1)-c1cc4cc(C(C)(C)C)cc5c4c4c1B3c1c-2cc(C(C)(C)C)cc1N4C(=O)O5 |
| InChI | InChI=1S/C35H34BNO2/c1-33(2,3)18-10-17-11-21-22-12-19(34(4,5)6)13-23-24-14-20(35(7,8)9)15-25-29(24)36(28(22)23)30(21)31-27(17)26(16-18)39-32(38)37(25)31/h10-16H,1-9H3 |
| InChIKey | PJCCPRRDOUPONL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|