C21H22N4O — CID 163254608
3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine (PubChem CID 163254608) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine.
| Compound Name | 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 163254608 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine |
| SMILES | C(#Cc1nc2c(nc1OCCN1CCCC1)=CCCN=2)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O/c1-2-7-17(8-3-1)10-11-19-21(26-16-15-25-13-4-5-14-25)24-18-9-6-12-22-20(18)23-19/h1-3,7-9H,4-6,12-16H2 |
| InChIKey | UJJKAPUQTBKGGQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|