About 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine
3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine (PubChem CID 163254608) has the molecular formula C21H22N4O
and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine |
| PubChem CID | 163254608 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine |
| SMILES | C(#Cc1nc2c(nc1OCCN1CCCC1)=CCCN=2)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O/c1-2-7-17(8-3-1)10-11-19-21(26-16-15-25-13-4-5-14-25)24-18-9-6-12-22-20(18)23-19/h1-3,7-9H,4-6,12-16H2 |
| InChIKey | UJJKAPUQTBKGGQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine?
The IUPAC name of 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine (CID 163254608) is 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine.
What is the SMILES notation for 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine?
The canonical SMILES for 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine is C(#Cc1nc2c(nc1OCCN1CCCC1)=CCCN=2)c1ccccc1.
What is the InChIKey of 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine?
The InChIKey is UJJKAPUQTBKGGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O/c1-2-7-17(8-3-1)10-11-19-21(26-16-15-25-13-4-5-14-25)24-18-9-6-12-22-20(18)23-19/h1-3,7-9H,4-6,12-16H2.
What are the key properties of 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine?
3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine has a molecular weight of 346.43 g/mol, XLogP of 1.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)-6,7-dihydropyrido[2,3-b]pyrazine is sourced from PubChem (CID 163254608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).