C15H24N2O3 — CID 163254978
(3aS,7aS)-1-(2-methylpropanoyl)-N-(2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 163254978) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (3aS,7aS)-1-(2-methylpropanoyl)-N-(2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (3aS,7aS)-1-(2-methylpropanoyl)-N-(2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 163254978 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (3aS,7aS)-1-(2-methylpropanoyl)-N-(2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CC(C)C(=O)N1C(C(=O)NCC=O)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C15H24N2O3/c1-10(2)15(20)17-12-6-4-3-5-11(12)9-13(17)14(19)16-7-8-18/h8,10-13H,3-7,9H2,1-2H3,(H,16,19)/t11-,12-,13?/m0/s1 |
| InChIKey | PFIOYIAKPPZXMH-VYAYZGMFSA-N |
| XLogP | 1.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|