C14H23NO3 — CID 69197311
propan-2-yl 1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 69197311) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is propan-2-yl 1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | propan-2-yl 1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 69197311 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | propan-2-yl 1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | CC(=O)N1C(C(=O)OC(C)C)CC2CCCCC21 |
| InChI | InChI=1S/C14H23NO3/c1-9(2)18-14(17)13-8-11-6-4-5-7-12(11)15(13)10(3)16/h9,11-13H,4-8H2,1-3H3 |
| InChIKey | QEMRPSBBZCLSCO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |