C21H33NO2 — CID 163652957
1-[(3aS,7aS)-2-acetyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclohexyl-3-methylbut-3-en-1-one (PubChem CID 163652957) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-[(3aS,7aS)-2-acetyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclohexyl-3-methylbut-3-en-1-one.
| Compound Name | 1-[(3aS,7aS)-2-acetyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclohexyl-3-methylbut-3-en-1-one |
|---|---|
| PubChem CID | 163652957 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 1-[(3aS,7aS)-2-acetyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclohexyl-3-methylbut-3-en-1-one |
| SMILES | C=C(C)C(C(=O)N1C(C(C)=O)C[C@@H]2CCCC[C@@H]21)C1CCCCC1 |
| InChI | InChI=1S/C21H33NO2/c1-14(2)20(16-9-5-4-6-10-16)21(24)22-18-12-8-7-11-17(18)13-19(22)15(3)23/h16-20H,1,4-13H2,2-3H3/t17-,18-,19?,20?/m0/s1 |
| InChIKey | INUKRTLCESFYGQ-VCAKUFKGSA-N |
| XLogP | 4.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|