C28H32N4O4 — CID 163255468
1,3-dicyclohexyl-6-hydroxy-5-(3-phenyl-2-prop-2-ynoyl-3,4-dihydropyrazol-5-yl)pyrimidine-2,4-dione (PubChem CID 163255468) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 1,3-dicyclohexyl-6-hydroxy-5-(3-phenyl-2-prop-2-ynoyl-3,4-dihydropyrazol-5-yl)pyrimidine-2,4-dione.
| Compound Name | 1,3-dicyclohexyl-6-hydroxy-5-(3-phenyl-2-prop-2-ynoyl-3,4-dihydropyrazol-5-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163255468 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 1,3-dicyclohexyl-6-hydroxy-5-(3-phenyl-2-prop-2-ynoyl-3,4-dihydropyrazol-5-yl)pyrimidine-2,4-dione |
| SMILES | C#CC(=O)N1N=C(c2c(O)n(C3CCCCC3)c(=O)n(C3CCCCC3)c2=O)CC1c1ccccc1 |
| InChI | InChI=1S/C28H32N4O4/c1-2-24(33)32-23(19-12-6-3-7-13-19)18-22(29-32)25-26(34)30(20-14-8-4-9-15-20)28(36)31(27(25)35)21-16-10-5-11-17-21/h1,3,6-7,12-13,20-21,23,34H,4-5,8-11,14-18H2 |
| InChIKey | GBPQROSDJJLXGE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|