C31H34N8O2 — CID 163257002
6-methyl-2-[4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide (PubChem CID 163257002) has the molecular formula C31H34N8O2 and a molecular weight of 550.67 g/mol. Its IUPAC name is 6-methyl-2-[4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide.
| Compound Name | 6-methyl-2-[4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 163257002 |
| Molecular Formula | C31H34N8O2 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 6-methyl-2-[4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide |
| SMILES | CC1Cn2c(c(C(=O)NCc3ccccc3-c3ccncn3)n(-c3ccc(N4CC5(CN(C)C5)C4)cc3)c2=O)CN1 |
| InChI | InChI=1S/C31H34N8O2/c1-21-15-38-27(14-33-21)28(29(40)34-13-22-5-3-4-6-25(22)26-11-12-32-20-35-26)39(30(38)41)24-9-7-23(8-10-24)37-18-31(19-37)16-36(2)17-31/h3-12,20-21,33H,13-19H2,1-2H3,(H,34,40) |
| InChIKey | LOUDHBTWMCPDNF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|