C26H24N8O3 — CID 163257069
2-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide (PubChem CID 163257069) has the molecular formula C26H24N8O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide.
| Compound Name | 2-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 163257069 |
| Molecular Formula | C26H24N8O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-3-oxo-N-[(2-pyrimidin-4-ylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxamide |
| SMILES | CC1Cn2c(c(C(=O)NCc3ccccc3-c3ccncn3)n(-c3ccc4oc(N)nc4c3)c2=O)CN1 |
| InChI | InChI=1S/C26H24N8O3/c1-15-13-33-21(12-29-15)23(34(26(33)36)17-6-7-22-20(10-17)32-25(27)37-22)24(35)30-11-16-4-2-3-5-18(16)19-8-9-28-14-31-19/h2-10,14-15,29H,11-13H2,1H3,(H2,27,32)(H,30,35) |
| InChIKey | AIQGXMVJFZRCJZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |