About ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine
ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine (PubChem CID 163257855) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 163257855 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC.COCCOCN1CC=C(C)CC1 |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-10-3-5-11(6-4-10)9-13-8-7-12-2;1-2/h3H,4-9H2,1-2H3;1-2H3 |
| InChIKey | MYJWHWVMTMXESN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine (CID 163257855) is ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine is CC.COCCOCN1CC=C(C)CC1.
What is the InChIKey of ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is MYJWHWVMTMXESN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.C2H6/c1-10-3-5-11(6-4-10)9-13-8-7-12-2;1-2/h3H,4-9H2,1-2H3;1-2H3.
What are the key properties of ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine?
ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 215.34 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-methoxyethoxymethyl)-4-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 163257855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).