C15H31NO — CID 145137534
1-(3-methoxy-2,2-dimethylpropyl)-4-methyl-3,6-dihydro-2H-pyridine;propane (PubChem CID 145137534) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 1-(3-methoxy-2,2-dimethylpropyl)-4-methyl-3,6-dihydro-2H-pyridine;propane.
| Compound Name | 1-(3-methoxy-2,2-dimethylpropyl)-4-methyl-3,6-dihydro-2H-pyridine;propane |
|---|---|
| PubChem CID | 145137534 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 1-(3-methoxy-2,2-dimethylpropyl)-4-methyl-3,6-dihydro-2H-pyridine;propane |
| SMILES | CCC.COCC(C)(C)CN1CC=C(C)CC1 |
| InChI | InChI=1S/C12H23NO.C3H8/c1-11-5-7-13(8-6-11)9-12(2,3)10-14-4;1-3-2/h5H,6-10H2,1-4H3;3H2,1-2H3 |
| InChIKey | YLIJPRICWUBFRS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|