About ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate
ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate (PubChem CID 163259499) has the molecular formula C23H32BrNO2
and a molecular weight of 434.42 g/mol. Its IUPAC name is ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate |
| PubChem CID | 163259499 |
| Molecular Formula | C23H32BrNO2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate |
| SMILES | CC.CC(C)OC(=O)C1CCN(C(C)c2cccc3c(Br)cccc23)CC1 |
| InChI | InChI=1S/C21H26BrNO2.C2H6/c1-14(2)25-21(24)16-10-12-23(13-11-16)15(3)17-6-4-8-19-18(17)7-5-9-20(19)22;1-2/h4-9,14-16H,10-13H2,1-3H3;1-2H3 |
| InChIKey | YBUKGHPIZZSQLQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate?
The IUPAC name of ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate (CID 163259499) is ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate.
What is the SMILES notation for ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate?
The canonical SMILES for ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate is CC.CC(C)OC(=O)C1CCN(C(C)c2cccc3c(Br)cccc23)CC1.
What is the InChIKey of ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate?
The InChIKey is YBUKGHPIZZSQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26BrNO2.C2H6/c1-14(2)25-21(24)16-10-12-23(13-11-16)15(3)17-6-4-8-19-18(17)7-5-9-20(19)22;1-2/h4-9,14-16H,10-13H2,1-3H3;1-2H3.
What are the key properties of ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate?
ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate has a molecular weight of 434.42 g/mol, XLogP of 6.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 1-[1-(5-bromonaphthalen-1-yl)ethyl]piperidine-4-carboxylate is sourced from PubChem (CID 163259499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).