C11H14N2 — CID 163261239
8a-methyl-1H-naphthalene-1,4-diamine (PubChem CID 163261239) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 8a-methyl-1H-naphthalene-1,4-diamine.
| Compound Name | 8a-methyl-1H-naphthalene-1,4-diamine |
|---|---|
| PubChem CID | 163261239 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 8a-methyl-1H-naphthalene-1,4-diamine |
| SMILES | CC12C=CC=CC1=C(N)C=CC2N |
| InChI | InChI=1S/C11H14N2/c1-11-7-3-2-4-8(11)9(12)5-6-10(11)13/h2-7,10H,12-13H2,1H3 |
| InChIKey | QUQFLYUQXBOBQY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |