C12H16N2O3 — CID 163261599
ethane;4-(2-hydroxyethyl)-1H-quinoxaline-2,3-dione (PubChem CID 163261599) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethane;4-(2-hydroxyethyl)-1H-quinoxaline-2,3-dione.
| Compound Name | ethane;4-(2-hydroxyethyl)-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 163261599 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethane;4-(2-hydroxyethyl)-1H-quinoxaline-2,3-dione |
| SMILES | CC.O=c1[nH]c2ccccc2n(CCO)c1=O |
| InChI | InChI=1S/C10H10N2O3.C2H6/c13-6-5-12-8-4-2-1-3-7(8)11-9(14)10(12)15;1-2/h1-4,13H,5-6H2,(H,11,14);1-2H3 |
| InChIKey | JWJLOEAIOBZSOC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|