C16H14N4O3 — CID 110396450
N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]pyridine-4-carboxamide (PubChem CID 110396450) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 110396450 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCn1c(=O)c(=O)[nH]c2ccccc21)c1ccncc1 |
| InChI | InChI=1S/C16H14N4O3/c21-14(11-5-7-17-8-6-11)18-9-10-20-13-4-2-1-3-12(13)19-15(22)16(20)23/h1-8H,9-10H2,(H,18,21)(H,19,22) |
| InChIKey | MQFWESHAXZJCOL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|