C17H14FN3O3 — CID 110396411
N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-fluorobenzamide (PubChem CID 110396411) has the molecular formula C17H14FN3O3 and a molecular weight of 327.32 g/mol. Its IUPAC name is N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-fluorobenzamide.
| Compound Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 110396411 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-fluorobenzamide |
| SMILES | O=C(NCCn1c(=O)c(=O)[nH]c2ccccc21)c1cccc(F)c1 |
| InChI | InChI=1S/C17H14FN3O3/c18-12-5-3-4-11(10-12)15(22)19-8-9-21-14-7-2-1-6-13(14)20-16(23)17(21)24/h1-7,10H,8-9H2,(H,19,22)(H,20,23) |
| InChIKey | MDWHUBLDTKTGOC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|