C15H17FN2O — CID 110716408
N-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-3-fluorobenzamide (PubChem CID 110716408) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is N-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-3-fluorobenzamide.
| Compound Name | N-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 110716408 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-3-fluorobenzamide |
| SMILES | Cc1ccc(C)n1CCNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H17FN2O/c1-11-6-7-12(2)18(11)9-8-17-15(19)13-4-3-5-14(16)10-13/h3-7,10H,8-9H2,1-2H3,(H,17,19) |
| InChIKey | NUVWLSRXMAWRBG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |