C17H11F4N3O3 — CID 113092143
2,3,4-trifluoro-N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]benzamide (PubChem CID 113092143) has the molecular formula C17H11F4N3O3 and a molecular weight of 381.29 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113092143 |
| Molecular Formula | C17H11F4N3O3 |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1c(=O)c(=O)[nH]c2cc(F)ccc21)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H11F4N3O3/c18-8-1-4-12-11(7-8)23-16(26)17(27)24(12)6-5-22-15(25)9-2-3-10(19)14(21)13(9)20/h1-4,7H,5-6H2,(H,22,25)(H,23,26) |
| InChIKey | WUKPTYLPVQZMDM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|