C17H16FN3O4S — CID 113092178
N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-methylbenzenesulfonamide (PubChem CID 113092178) has the molecular formula C17H16FN3O4S and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113092178 |
| Molecular Formula | C17H16FN3O4S |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCCn2c(=O)c(=O)[nH]c3cc(F)ccc32)c1 |
| InChI | InChI=1S/C17H16FN3O4S/c1-11-3-2-4-13(9-11)26(24,25)19-7-8-21-15-6-5-12(18)10-14(15)20-16(22)17(21)23/h2-6,9-10,19H,7-8H2,1H3,(H,20,22) |
| InChIKey | IIDQJOWFKZETGR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|