C12H15FN4O4S — CID 113092163
4-[2-(dimethylsulfamoylamino)ethyl]-7-fluoro-2,3-dioxo-1H-quinoxaline (PubChem CID 113092163) has the molecular formula C12H15FN4O4S and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[2-(dimethylsulfamoylamino)ethyl]-7-fluoro-2,3-dioxo-1H-quinoxaline.
| Compound Name | 4-[2-(dimethylsulfamoylamino)ethyl]-7-fluoro-2,3-dioxo-1H-quinoxaline |
|---|---|
| PubChem CID | 113092163 |
| Molecular Formula | C12H15FN4O4S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-[2-(dimethylsulfamoylamino)ethyl]-7-fluoro-2,3-dioxo-1H-quinoxaline |
| SMILES | CN(C)S(=O)(=O)NCCn1c(=O)c(=O)[nH]c2cc(F)ccc21 |
| InChI | InChI=1S/C12H15FN4O4S/c1-16(2)22(20,21)14-5-6-17-10-4-3-8(13)7-9(10)15-11(18)12(17)19/h3-4,7,14H,5-6H2,1-2H3,(H,15,18) |
| InChIKey | SPVOAFLJLWGGRX-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|